C16H22N5O3+ — CID 73328381
6-(3-methoxypropyl)-4,7-dimethyl-2-prop-2-enyl-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione (PubChem CID 73328381) has the molecular formula C16H22N5O3+ and a molecular weight of 332.38 g/mol. Its IUPAC name is 6-(3-methoxypropyl)-4,7-dimethyl-2-prop-2-enyl-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione.
| Compound Name | 6-(3-methoxypropyl)-4,7-dimethyl-2-prop-2-enyl-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione |
|---|---|
| PubChem CID | 73328381 |
| Molecular Formula | C16H22N5O3+ |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 6-(3-methoxypropyl)-4,7-dimethyl-2-prop-2-enyl-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione |
| SMILES | C=CCN1C(=O)C2C(=Nc3n(CCCOC)c(C)c[n+]32)N(C)C1=O |
| InChI | InChI=1S/C16H22N5O3/c1-5-7-20-14(22)12-13(18(3)16(20)23)17-15-19(8-6-9-24-4)11(2)10-21(12)15/h5,10,12H,1,6-9H2,2-4H3/q+1 |
| InChIKey | QLIISOSBNVZKBI-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 71.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|