C16H22N5O5+ — CID 73328385
methyl 2-[6-(3-methoxypropyl)-4,7-dimethyl-1,3-dioxo-9aH-purino[7,8-a]imidazol-9-ium-2-yl]acetate (PubChem CID 73328385) has the molecular formula C16H22N5O5+ and a molecular weight of 364.38 g/mol. Its IUPAC name is methyl 2-[6-(3-methoxypropyl)-4,7-dimethyl-1,3-dioxo-9aH-purino[7,8-a]imidazol-9-ium-2-yl]acetate.
| Compound Name | methyl 2-[6-(3-methoxypropyl)-4,7-dimethyl-1,3-dioxo-9aH-purino[7,8-a]imidazol-9-ium-2-yl]acetate |
|---|---|
| PubChem CID | 73328385 |
| Molecular Formula | C16H22N5O5+ |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | methyl 2-[6-(3-methoxypropyl)-4,7-dimethyl-1,3-dioxo-9aH-purino[7,8-a]imidazol-9-ium-2-yl]acetate |
| SMILES | COCCCn1c(C)c[n+]2c1N=C1C2C(=O)N(CC(=O)OC)C(=O)N1C |
| InChI | InChI=1S/C16H22N5O5/c1-10-8-20-12-13(17-15(20)19(10)6-5-7-25-3)18(2)16(24)21(14(12)23)9-11(22)26-4/h8,12H,5-7,9H2,1-4H3/q+1 |
| InChIKey | CGOQSWMBAHNJRJ-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 97.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|