C18H26N5O4+ — CID 73281605
ethyl 2-[4,7-dimethyl-2-(3-methylbutyl)-1,3-dioxo-9aH-purino[7,8-a]imidazol-9-ium-6-yl]acetate (PubChem CID 73281605) has the molecular formula C18H26N5O4+ and a molecular weight of 376.44 g/mol. Its IUPAC name is ethyl 2-[4,7-dimethyl-2-(3-methylbutyl)-1,3-dioxo-9aH-purino[7,8-a]imidazol-9-ium-6-yl]acetate.
| Compound Name | ethyl 2-[4,7-dimethyl-2-(3-methylbutyl)-1,3-dioxo-9aH-purino[7,8-a]imidazol-9-ium-6-yl]acetate |
|---|---|
| PubChem CID | 73281605 |
| Molecular Formula | C18H26N5O4+ |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | ethyl 2-[4,7-dimethyl-2-(3-methylbutyl)-1,3-dioxo-9aH-purino[7,8-a]imidazol-9-ium-6-yl]acetate |
| SMILES | CCOC(=O)Cn1c(C)c[n+]2c1N=C1C2C(=O)N(CCC(C)C)C(=O)N1C |
| InChI | InChI=1S/C18H26N5O4/c1-6-27-13(24)10-22-12(4)9-23-14-15(19-17(22)23)20(5)18(26)21(16(14)25)8-7-11(2)3/h9,11,14H,6-8,10H2,1-5H3/q+1 |
| InChIKey | MJVNVMWVYLOFRI-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 88.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|