C20H25N6O3+ — CID 73402608
6-[3-(4-methoxyanilino)propyl]-2,4,7-trimethyl-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione (PubChem CID 73402608) has the molecular formula C20H25N6O3+ and a molecular weight of 397.46 g/mol. Its IUPAC name is 6-[3-(4-methoxyanilino)propyl]-2,4,7-trimethyl-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione.
| Compound Name | 6-[3-(4-methoxyanilino)propyl]-2,4,7-trimethyl-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione |
|---|---|
| PubChem CID | 73402608 |
| Molecular Formula | C20H25N6O3+ |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 6-[3-(4-methoxyanilino)propyl]-2,4,7-trimethyl-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione |
| SMILES | COc1ccc(NCCCn2c(C)c[n+]3c2N=C2C3C(=O)N(C)C(=O)N2C)cc1 |
| InChI | InChI=1S/C20H25N6O3/c1-13-12-26-16-17(23(2)20(28)24(3)18(16)27)22-19(26)25(13)11-5-10-21-14-6-8-15(29-4)9-7-14/h6-9,12,16,21H,5,10-11H2,1-4H3/q+1 |
| InChIKey | GGJCZHRULVNQOB-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|