C19H23N6O2+ — CID 73394723
2,4,7-trimethyl-6-[2-(4-methylanilino)ethyl]-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione (PubChem CID 73394723) has the molecular formula C19H23N6O2+ and a molecular weight of 367.43 g/mol. Its IUPAC name is 2,4,7-trimethyl-6-[2-(4-methylanilino)ethyl]-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione.
| Compound Name | 2,4,7-trimethyl-6-[2-(4-methylanilino)ethyl]-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione |
|---|---|
| PubChem CID | 73394723 |
| Molecular Formula | C19H23N6O2+ |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 2,4,7-trimethyl-6-[2-(4-methylanilino)ethyl]-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione |
| SMILES | Cc1ccc(NCCn2c(C)c[n+]3c2N=C2C3C(=O)N(C)C(=O)N2C)cc1 |
| InChI | InChI=1S/C19H23N6O2/c1-12-5-7-14(8-6-12)20-9-10-24-13(2)11-25-15-16(21-18(24)25)22(3)19(27)23(4)17(15)26/h5-8,11,15,20H,9-10H2,1-4H3/q+1 |
| InChIKey | IFVNEJSHDBMDSJ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 73.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|