C22H26N5O3+ — CID 74690219
4,7-dimethyl-2-[(4-methylphenyl)methyl]-6-(oxolan-2-ylmethyl)-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione (PubChem CID 74690219) has the molecular formula C22H26N5O3+ and a molecular weight of 408.48 g/mol. Its IUPAC name is 4,7-dimethyl-2-[(4-methylphenyl)methyl]-6-(oxolan-2-ylmethyl)-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione.
| Compound Name | 4,7-dimethyl-2-[(4-methylphenyl)methyl]-6-(oxolan-2-ylmethyl)-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione |
|---|---|
| PubChem CID | 74690219 |
| Molecular Formula | C22H26N5O3+ |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 4,7-dimethyl-2-[(4-methylphenyl)methyl]-6-(oxolan-2-ylmethyl)-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione |
| SMILES | Cc1ccc(CN2C(=O)C3C(=Nc4n(CC5CCCO5)c(C)c[n+]43)N(C)C2=O)cc1 |
| InChI | InChI=1S/C22H26N5O3/c1-14-6-8-16(9-7-14)12-27-20(28)18-19(24(3)22(27)29)23-21-25(15(2)11-26(18)21)13-17-5-4-10-30-17/h6-9,11,17-18H,4-5,10,12-13H2,1-3H3/q+1 |
| InChIKey | MHEFQMVOIBXPMB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 71.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|