C17H17FN5O2+ — CID 78305622
6-[(4-fluorophenyl)methyl]-2,4,7-trimethyl-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione (PubChem CID 78305622) has the molecular formula C17H17FN5O2+ and a molecular weight of 342.35 g/mol. Its IUPAC name is 6-[(4-fluorophenyl)methyl]-2,4,7-trimethyl-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione.
| Compound Name | 6-[(4-fluorophenyl)methyl]-2,4,7-trimethyl-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione |
|---|---|
| PubChem CID | 78305622 |
| Molecular Formula | C17H17FN5O2+ |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 6-[(4-fluorophenyl)methyl]-2,4,7-trimethyl-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione |
| SMILES | Cc1c[n+]2c(n1Cc1ccc(F)cc1)N=C1C2C(=O)N(C)C(=O)N1C |
| InChI | InChI=1S/C17H17FN5O2/c1-10-8-23-13-14(20(2)17(25)21(3)15(13)24)19-16(23)22(10)9-11-4-6-12(18)7-5-11/h4-8,13H,9H2,1-3H3/q+1 |
| InChIKey | IUESPPCGHQEARF-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 61.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|