C23H21FN5O2+ — CID 73265869
6-(3,4-dimethylphenyl)-7-(4-fluorophenyl)-2,4-dimethyl-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione (PubChem CID 73265869) has the molecular formula C23H21FN5O2+ and a molecular weight of 418.45 g/mol. Its IUPAC name is 6-(3,4-dimethylphenyl)-7-(4-fluorophenyl)-2,4-dimethyl-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione.
| Compound Name | 6-(3,4-dimethylphenyl)-7-(4-fluorophenyl)-2,4-dimethyl-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione |
|---|---|
| PubChem CID | 73265869 |
| Molecular Formula | C23H21FN5O2+ |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 6-(3,4-dimethylphenyl)-7-(4-fluorophenyl)-2,4-dimethyl-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione |
| SMILES | Cc1ccc(-n2c(-c3ccc(F)cc3)c[n+]3c2N=C2C3C(=O)N(C)C(=O)N2C)cc1C |
| InChI | InChI=1S/C23H21FN5O2/c1-13-5-10-17(11-14(13)2)29-18(15-6-8-16(24)9-7-15)12-28-19-20(25-22(28)29)26(3)23(31)27(4)21(19)30/h5-12,19H,1-4H3/q+1 |
| InChIKey | VXVNFYMNCGLUKM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 61.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|