C21H26N5O3+ — CID 73276746
9-(3,5-dimethylphenyl)-1,7-dimethyl-3-(2-oxopropyl)-4a,6,7,8-tetrahydropurino[7,8-a]pyrimidin-5-ium-2,4-dione (PubChem CID 73276746) has the molecular formula C21H26N5O3+ and a molecular weight of 396.47 g/mol. Its IUPAC name is 9-(3,5-dimethylphenyl)-1,7-dimethyl-3-(2-oxopropyl)-4a,6,7,8-tetrahydropurino[7,8-a]pyrimidin-5-ium-2,4-dione.
| Compound Name | 9-(3,5-dimethylphenyl)-1,7-dimethyl-3-(2-oxopropyl)-4a,6,7,8-tetrahydropurino[7,8-a]pyrimidin-5-ium-2,4-dione |
|---|---|
| PubChem CID | 73276746 |
| Molecular Formula | C21H26N5O3+ |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 9-(3,5-dimethylphenyl)-1,7-dimethyl-3-(2-oxopropyl)-4a,6,7,8-tetrahydropurino[7,8-a]pyrimidin-5-ium-2,4-dione |
| SMILES | CC(=O)CN1C(=O)C2C(=NC3=[N+]2CC(C)CN3c2cc(C)cc(C)c2)N(C)C1=O |
| InChI | InChI=1S/C21H26N5O3/c1-12-6-13(2)8-16(7-12)24-9-14(3)10-25-17-18(22-20(24)25)23(5)21(29)26(19(17)28)11-15(4)27/h6-8,14,17H,9-11H2,1-5H3/q+1 |
| InChIKey | KZTMQNAUDALULW-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|