C22H30N5O3+ — CID 167999245
9-(4-ethoxyphenyl)-1,7-dimethyl-3-(2-methylpropyl)-4a,6,7,8-tetrahydropurino[7,8-a]pyrimidin-5-ium-2,4-dione (PubChem CID 167999245) has the molecular formula C22H30N5O3+ and a molecular weight of 412.51 g/mol. Its IUPAC name is 9-(4-ethoxyphenyl)-1,7-dimethyl-3-(2-methylpropyl)-4a,6,7,8-tetrahydropurino[7,8-a]pyrimidin-5-ium-2,4-dione.
| Compound Name | 9-(4-ethoxyphenyl)-1,7-dimethyl-3-(2-methylpropyl)-4a,6,7,8-tetrahydropurino[7,8-a]pyrimidin-5-ium-2,4-dione |
|---|---|
| PubChem CID | 167999245 |
| Molecular Formula | C22H30N5O3+ |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | 9-(4-ethoxyphenyl)-1,7-dimethyl-3-(2-methylpropyl)-4a,6,7,8-tetrahydropurino[7,8-a]pyrimidin-5-ium-2,4-dione |
| SMILES | CCOc1ccc(N2CC(C)C[N+]3=C2N=C2C3C(=O)N(CC(C)C)C(=O)N2C)cc1 |
| InChI | InChI=1S/C22H30N5O3/c1-6-30-17-9-7-16(8-10-17)25-12-15(4)13-26-18-19(23-21(25)26)24(5)22(29)27(20(18)28)11-14(2)3/h7-10,14-15,18H,6,11-13H2,1-5H3/q+1 |
| InChIKey | JPESYMCSPQPIMN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|