C19H23N6O4+ — CID 167999303
2-[9-(3-methoxyphenyl)-1,7-dimethyl-2,4-dioxo-4a,6,7,8-tetrahydropurino[7,8-a]pyrimidin-5-ium-3-yl]acetamide (PubChem CID 167999303) has the molecular formula C19H23N6O4+ and a molecular weight of 399.43 g/mol. Its IUPAC name is 2-[9-(3-methoxyphenyl)-1,7-dimethyl-2,4-dioxo-4a,6,7,8-tetrahydropurino[7,8-a]pyrimidin-5-ium-3-yl]acetamide.
| Compound Name | 2-[9-(3-methoxyphenyl)-1,7-dimethyl-2,4-dioxo-4a,6,7,8-tetrahydropurino[7,8-a]pyrimidin-5-ium-3-yl]acetamide |
|---|---|
| PubChem CID | 167999303 |
| Molecular Formula | C19H23N6O4+ |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 2-[9-(3-methoxyphenyl)-1,7-dimethyl-2,4-dioxo-4a,6,7,8-tetrahydropurino[7,8-a]pyrimidin-5-ium-3-yl]acetamide |
| SMILES | COc1cccc(N2CC(C)C[N+]3=C2N=C2C3C(=O)N(CC(N)=O)C(=O)N2C)c1 |
| InChI | InChI=1S/C19H22N6O4/c1-11-8-23(12-5-4-6-13(7-12)29-3)18-21-16-15(24(18)9-11)17(27)25(10-14(20)26)19(28)22(16)2/h4-7,11,15H,8-10H2,1-3H3,(H-,20,26)/p+1 |
| InChIKey | VCSDCIMQEMAVAB-UHFFFAOYSA-O |
| XLogP | -0.32 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|