C17H24N7O3+ — CID 73338396
2-[8-(3,5-diethylpyrazol-1-yl)-7-ethyl-3-methyl-2,6-dioxo-5H-purin-7-ium-1-yl]acetamide (PubChem CID 73338396) has the molecular formula C17H24N7O3+ and a molecular weight of 374.43 g/mol. Its IUPAC name is 2-[8-(3,5-diethylpyrazol-1-yl)-7-ethyl-3-methyl-2,6-dioxo-5H-purin-7-ium-1-yl]acetamide.
| Compound Name | 2-[8-(3,5-diethylpyrazol-1-yl)-7-ethyl-3-methyl-2,6-dioxo-5H-purin-7-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 73338396 |
| Molecular Formula | C17H24N7O3+ |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 2-[8-(3,5-diethylpyrazol-1-yl)-7-ethyl-3-methyl-2,6-dioxo-5H-purin-7-ium-1-yl]acetamide |
| SMILES | CCc1cc(CC)n(C2=[N+](CC)C3C(=O)N(CC(N)=O)C(=O)N(C)C3=N2)n1 |
| InChI | InChI=1S/C17H23N7O3/c1-5-10-8-11(6-2)24(20-10)16-19-14-13(22(16)7-3)15(26)23(9-12(18)25)17(27)21(14)4/h8,13H,5-7,9H2,1-4H3,(H-,18,25)/p+1 |
| InChIKey | XOYUDHJWPRJNCK-UHFFFAOYSA-O |
| XLogP | -0.60 |
| TPSA | 116.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|