C20H29N6O3+ — CID 73338279
3-methyl-7-(3-methylbutyl)-1-(2-oxopropyl)-8-(3,4,5-trimethylpyrazol-1-yl)-5H-purin-7-ium-2,6-dione (PubChem CID 73338279) has the molecular formula C20H29N6O3+ and a molecular weight of 401.49 g/mol. Its IUPAC name is 3-methyl-7-(3-methylbutyl)-1-(2-oxopropyl)-8-(3,4,5-trimethylpyrazol-1-yl)-5H-purin-7-ium-2,6-dione.
| Compound Name | 3-methyl-7-(3-methylbutyl)-1-(2-oxopropyl)-8-(3,4,5-trimethylpyrazol-1-yl)-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 73338279 |
| Molecular Formula | C20H29N6O3+ |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | 3-methyl-7-(3-methylbutyl)-1-(2-oxopropyl)-8-(3,4,5-trimethylpyrazol-1-yl)-5H-purin-7-ium-2,6-dione |
| SMILES | CC(=O)CN1C(=O)C2C(=NC(n3nc(C)c(C)c3C)=[N+]2CCC(C)C)N(C)C1=O |
| InChI | InChI=1S/C20H29N6O3/c1-11(2)8-9-24-16-17(21-19(24)26-15(6)13(4)14(5)22-26)23(7)20(29)25(18(16)28)10-12(3)27/h11,16H,8-10H2,1-7H3/q+1 |
| InChIKey | SNNHYSCJDGFYSP-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 90.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|