C24H27N6O4+ — CID 74532372
benzyl 2-[3-methyl-2,6-dioxo-7-prop-2-enyl-8-(3,4,5-trimethylpyrazol-1-yl)-5H-purin-7-ium-1-yl]acetate (PubChem CID 74532372) has the molecular formula C24H27N6O4+ and a molecular weight of 463.52 g/mol. Its IUPAC name is benzyl 2-[3-methyl-2,6-dioxo-7-prop-2-enyl-8-(3,4,5-trimethylpyrazol-1-yl)-5H-purin-7-ium-1-yl]acetate.
| Compound Name | benzyl 2-[3-methyl-2,6-dioxo-7-prop-2-enyl-8-(3,4,5-trimethylpyrazol-1-yl)-5H-purin-7-ium-1-yl]acetate |
|---|---|
| PubChem CID | 74532372 |
| Molecular Formula | C24H27N6O4+ |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | benzyl 2-[3-methyl-2,6-dioxo-7-prop-2-enyl-8-(3,4,5-trimethylpyrazol-1-yl)-5H-purin-7-ium-1-yl]acetate |
| SMILES | C=CC[N+]1=C(n2nc(C)c(C)c2C)N=C2C1C(=O)N(CC(=O)OCc1ccccc1)C(=O)N2C |
| InChI | InChI=1S/C24H27N6O4/c1-6-12-28-20-21(25-23(28)30-17(4)15(2)16(3)26-30)27(5)24(33)29(22(20)32)13-19(31)34-14-18-10-8-7-9-11-18/h6-11,20H,1,12-14H2,2-5H3/q+1 |
| InChIKey | XZOKWKANOVCKPK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 100.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|