C18H21N6O2+ — CID 167997561
1,3-dimethyl-8-[(2E)-2-(1-phenylethylidene)hydrazinyl]-7-prop-2-enyl-5H-purin-7-ium-2,6-dione (PubChem CID 167997561) has the molecular formula C18H21N6O2+ and a molecular weight of 353.41 g/mol. Its IUPAC name is 1,3-dimethyl-8-[(2E)-2-(1-phenylethylidene)hydrazinyl]-7-prop-2-enyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 1,3-dimethyl-8-[(2E)-2-(1-phenylethylidene)hydrazinyl]-7-prop-2-enyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 167997561 |
| Molecular Formula | C18H21N6O2+ |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 1,3-dimethyl-8-[(2E)-2-(1-phenylethylidene)hydrazinyl]-7-prop-2-enyl-5H-purin-7-ium-2,6-dione |
| SMILES | C=CC[N+]1=C(N/N=C(\C)c2ccccc2)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C18H20N6O2/c1-5-11-24-14-15(22(3)18(26)23(4)16(14)25)19-17(24)21-20-12(2)13-9-7-6-8-10-13/h5-10,14H,1,11H2,2-4H3/p+1/b20-12+ |
| InChIKey | VAMKFALJRDRNCL-UDWIEESQSA-O |
| XLogP | 0.86 |
| TPSA | 80.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|