C22H21N4O3S+ — CID 78212374
7-benzyl-1,3-dimethyl-8-phenacylsulfanyl-5H-purin-7-ium-2,6-dione (PubChem CID 78212374) has the molecular formula C22H21N4O3S+ and a molecular weight of 421.50 g/mol. Its IUPAC name is 7-benzyl-1,3-dimethyl-8-phenacylsulfanyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 7-benzyl-1,3-dimethyl-8-phenacylsulfanyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 78212374 |
| Molecular Formula | C22H21N4O3S+ |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 7-benzyl-1,3-dimethyl-8-phenacylsulfanyl-5H-purin-7-ium-2,6-dione |
| SMILES | CN1C(=O)C2C(=NC(SCC(=O)c3ccccc3)=[N+]2Cc2ccccc2)N(C)C1=O |
| InChI | InChI=1S/C22H21N4O3S/c1-24-19-18(20(28)25(2)22(24)29)26(13-15-9-5-3-6-10-15)21(23-19)30-14-17(27)16-11-7-4-8-12-16/h3-12,18H,13-14H2,1-2H3/q+1 |
| InChIKey | CTXXHNBMRKLNRC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 73.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|