C19H25N4O2S+ — CID 78212941
8-benzylsulfanyl-1,3-dimethyl-7-(3-methylbutyl)-5H-purin-7-ium-2,6-dione (PubChem CID 78212941) has the molecular formula C19H25N4O2S+ and a molecular weight of 373.50 g/mol. Its IUPAC name is 8-benzylsulfanyl-1,3-dimethyl-7-(3-methylbutyl)-5H-purin-7-ium-2,6-dione.
| Compound Name | 8-benzylsulfanyl-1,3-dimethyl-7-(3-methylbutyl)-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 78212941 |
| Molecular Formula | C19H25N4O2S+ |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 8-benzylsulfanyl-1,3-dimethyl-7-(3-methylbutyl)-5H-purin-7-ium-2,6-dione |
| SMILES | CC(C)CC[N+]1=C(SCc2ccccc2)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C19H25N4O2S/c1-13(2)10-11-23-15-16(21(3)19(25)22(4)17(15)24)20-18(23)26-12-14-8-6-5-7-9-14/h5-9,13,15H,10-12H2,1-4H3/q+1 |
| InChIKey | ZLBBYAIRIPVJSD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|