C23H24ClN4O2S+ — CID 78350895
8-[(2-chlorophenyl)methylsulfanyl]-1,3-dimethyl-7-(3-phenylpropyl)-5H-purin-7-ium-2,6-dione (PubChem CID 78350895) has the molecular formula C23H24ClN4O2S+ and a molecular weight of 455.99 g/mol. Its IUPAC name is 8-[(2-chlorophenyl)methylsulfanyl]-1,3-dimethyl-7-(3-phenylpropyl)-5H-purin-7-ium-2,6-dione.
| Compound Name | 8-[(2-chlorophenyl)methylsulfanyl]-1,3-dimethyl-7-(3-phenylpropyl)-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 78350895 |
| Molecular Formula | C23H24ClN4O2S+ |
| Molecular Weight | 455.99 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 8-[(2-chlorophenyl)methylsulfanyl]-1,3-dimethyl-7-(3-phenylpropyl)-5H-purin-7-ium-2,6-dione |
| SMILES | CN1C(=O)C2C(=NC(SCc3ccccc3Cl)=[N+]2CCCc2ccccc2)N(C)C1=O |
| InChI | InChI=1S/C23H24ClN4O2S/c1-26-20-19(21(29)27(2)23(26)30)28(14-8-11-16-9-4-3-5-10-16)22(25-20)31-15-17-12-6-7-13-18(17)24/h3-7,9-10,12-13,19H,8,11,14-15H2,1-2H3/q+1 |
| InChIKey | LNWCYPXXRGXFOZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.99 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|