C21H28N5O3S+ — CID 78304276
2-[(7-hexyl-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl)sulfanyl]-N-phenylacetamide (PubChem CID 78304276) has the molecular formula C21H28N5O3S+ and a molecular weight of 430.55 g/mol. Its IUPAC name is 2-[(7-hexyl-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl)sulfanyl]-N-phenylacetamide.
| Compound Name | 2-[(7-hexyl-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl)sulfanyl]-N-phenylacetamide |
|---|---|
| PubChem CID | 78304276 |
| Molecular Formula | C21H28N5O3S+ |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 2-[(7-hexyl-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl)sulfanyl]-N-phenylacetamide |
| SMILES | CCCCCC[N+]1=C(SCC(=O)Nc2ccccc2)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C21H27N5O3S/c1-4-5-6-10-13-26-17-18(24(2)21(29)25(3)19(17)28)23-20(26)30-14-16(27)22-15-11-8-7-9-12-15/h7-9,11-12,17H,4-6,10,13-14H2,1-3H3/p+1 |
| InChIKey | BYTHKQCQGVYKEA-UHFFFAOYSA-O |
| XLogP | 2.61 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|