C20H26FN3O3S — CID 42884075
N-(4-fluorophenyl)-2-(1-octyl-4,6-dioxopyrimidin-2-yl)sulfanylacetamide (PubChem CID 42884075) has the molecular formula C20H26FN3O3S and a molecular weight of 407.51 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-(1-octyl-4,6-dioxopyrimidin-2-yl)sulfanylacetamide.
| Compound Name | N-(4-fluorophenyl)-2-(1-octyl-4,6-dioxopyrimidin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 42884075 |
| Molecular Formula | C20H26FN3O3S |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | N-(4-fluorophenyl)-2-(1-octyl-4,6-dioxopyrimidin-2-yl)sulfanylacetamide |
| SMILES | CCCCCCCCN1C(=O)CC(=O)N=C1SCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C20H26FN3O3S/c1-2-3-4-5-6-7-12-24-19(27)13-17(25)23-20(24)28-14-18(26)22-16-10-8-15(21)9-11-16/h8-11H,2-7,12-14H2,1H3,(H,22,26) |
| InChIKey | GOBLGEUIRRRFOH-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|