C22H23N6O4+ — CID 137265900
8-[(2E)-2-[(2,4-dihydroxyphenyl)methylidene]hydrazinyl]-1,3-dimethyl-7-(2-phenylethyl)-5H-purin-7-ium-2,6-dione (PubChem CID 137265900) has the molecular formula C22H23N6O4+ and a molecular weight of 435.46 g/mol. Its IUPAC name is 8-[(2E)-2-[(2,4-dihydroxyphenyl)methylidene]hydrazinyl]-1,3-dimethyl-7-(2-phenylethyl)-5H-purin-7-ium-2,6-dione.
| Compound Name | 8-[(2E)-2-[(2,4-dihydroxyphenyl)methylidene]hydrazinyl]-1,3-dimethyl-7-(2-phenylethyl)-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 137265900 |
| Molecular Formula | C22H23N6O4+ |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 8-[(2E)-2-[(2,4-dihydroxyphenyl)methylidene]hydrazinyl]-1,3-dimethyl-7-(2-phenylethyl)-5H-purin-7-ium-2,6-dione |
| SMILES | CN1C(=O)C2C(=NC(N/N=C/c3ccc(O)cc3O)=[N+]2CCc2ccccc2)N(C)C1=O |
| InChI | InChI=1S/C22H22N6O4/c1-26-19-18(20(31)27(2)22(26)32)28(11-10-14-6-4-3-5-7-14)21(24-19)25-23-13-15-8-9-16(29)12-17(15)30/h3-9,12-13,18H,10-11H2,1-2H3,(H2,23,29,30)/p+1 |
| InChIKey | OVQVEXYJJIMRIN-UHFFFAOYSA-O |
| XLogP | 0.94 |
| TPSA | 120.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|