C14H22N5O2+ — CID 78204419
8-(butan-2-ylamino)-1,3-dimethyl-7-prop-2-enyl-5H-purin-7-ium-2,6-dione (PubChem CID 78204419) has the molecular formula C14H22N5O2+ and a molecular weight of 292.36 g/mol. Its IUPAC name is 8-(butan-2-ylamino)-1,3-dimethyl-7-prop-2-enyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 8-(butan-2-ylamino)-1,3-dimethyl-7-prop-2-enyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 78204419 |
| Molecular Formula | C14H22N5O2+ |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 8-(butan-2-ylamino)-1,3-dimethyl-7-prop-2-enyl-5H-purin-7-ium-2,6-dione |
| SMILES | C=CC[N+]1=C(NC(C)CC)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C14H21N5O2/c1-6-8-19-10-11(16-13(19)15-9(3)7-2)17(4)14(21)18(5)12(10)20/h6,9-10H,1,7-8H2,2-5H3/p+1 |
| InChIKey | LONFCDIVEDASEB-UHFFFAOYSA-O |
| XLogP | 0.23 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|