C13H21N6O3+ — CID 74776569
N-ethyl-2-[8-(ethylamino)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl]acetamide (PubChem CID 74776569) has the molecular formula C13H21N6O3+ and a molecular weight of 309.35 g/mol. Its IUPAC name is N-ethyl-2-[8-(ethylamino)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl]acetamide.
| Compound Name | N-ethyl-2-[8-(ethylamino)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl]acetamide |
|---|---|
| PubChem CID | 74776569 |
| Molecular Formula | C13H21N6O3+ |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | N-ethyl-2-[8-(ethylamino)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl]acetamide |
| SMILES | CCNC(=O)C[N+]1=C(NCC)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C13H20N6O3/c1-5-14-8(20)7-19-9-10(16-12(19)15-6-2)17(3)13(22)18(4)11(9)21/h9H,5-7H2,1-4H3,(H,14,20)/p+1 |
| InChIKey | NEWKZTXAHICUAQ-UHFFFAOYSA-O |
| XLogP | -1.60 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|