C22H23ClN5O2+ — CID 78333785
7-[(4-chlorophenyl)methyl]-1,3-dimethyl-8-(2-phenylethylamino)-5H-purin-7-ium-2,6-dione (PubChem CID 78333785) has the molecular formula C22H23ClN5O2+ and a molecular weight of 424.91 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)methyl]-1,3-dimethyl-8-(2-phenylethylamino)-5H-purin-7-ium-2,6-dione.
| Compound Name | 7-[(4-chlorophenyl)methyl]-1,3-dimethyl-8-(2-phenylethylamino)-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 78333785 |
| Molecular Formula | C22H23ClN5O2+ |
| Molecular Weight | 424.91 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 7-[(4-chlorophenyl)methyl]-1,3-dimethyl-8-(2-phenylethylamino)-5H-purin-7-ium-2,6-dione |
| SMILES | CN1C(=O)C2C(=NC(NCCc3ccccc3)=[N+]2Cc2ccc(Cl)cc2)N(C)C1=O |
| InChI | InChI=1S/C22H22ClN5O2/c1-26-19-18(20(29)27(2)22(26)30)28(14-16-8-10-17(23)11-9-16)21(25-19)24-13-12-15-6-4-3-5-7-15/h3-11,18H,12-14H2,1-2H3/p+1 |
| InChIKey | UZXADYFZGVSWPH-UHFFFAOYSA-O |
| XLogP | 2.35 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.91 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|