C9H12BrN4O3+ — CID 85289440
8-bromo-7-(2-hydroxyethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 85289440) has the molecular formula C9H12BrN4O3+ and a molecular weight of 304.12 g/mol. Its IUPAC name is 8-bromo-7-(2-hydroxyethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 8-bromo-7-(2-hydroxyethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 85289440 |
| Molecular Formula | C9H12BrN4O3+ |
| Molecular Weight | 304.12 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | 8-bromo-7-(2-hydroxyethyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | CN1C(=O)C2C(=NC(Br)=[N+]2CCO)N(C)C1=O |
| InChI | InChI=1S/C9H12BrN4O3/c1-12-6-5(7(16)13(2)9(12)17)14(3-4-15)8(10)11-6/h5,15H,3-4H2,1-2H3/q+1 |
| InChIKey | XVKHMQRMHQUOJW-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.12 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|