C8H12N5O2+ — CID 78169388
8-amino-1,3,7-trimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 78169388) has the molecular formula C8H12N5O2+ and a molecular weight of 210.22 g/mol. Its IUPAC name is 8-amino-1,3,7-trimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 8-amino-1,3,7-trimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 78169388 |
| Molecular Formula | C8H12N5O2+ |
| Molecular Weight | 210.22 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 8-amino-1,3,7-trimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | CN1C(=O)C2C(=NC(N)=[N+]2C)N(C)C1=O |
| InChI | InChI=1S/C8H11N5O2/c1-11-4-5(10-7(11)9)12(2)8(15)13(3)6(4)14/h4,9H,1-3H3/p+1 |
| InChIKey | KEWDFESGLRDGPT-UHFFFAOYSA-O |
| XLogP | -1.75 |
| TPSA | 82.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.22 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|