C12H9N4O3S+ — CID 75609195
4,6-dimethyl-10-thia-4,6,8-triaza-1-azoniatetracyclo[7.6.0.02,7.011,15]pentadeca-1(9),7,11(15),12-tetraene-3,5,14-trione (PubChem CID 75609195) has the molecular formula C12H9N4O3S+ and a molecular weight of 289.30 g/mol. Its IUPAC name is 4,6-dimethyl-10-thia-4,6,8-triaza-1-azoniatetracyclo[7.6.0.02,7.011,15]pentadeca-1(9),7,11(15),12-tetraene-3,5,14-trione.
| Compound Name | 4,6-dimethyl-10-thia-4,6,8-triaza-1-azoniatetracyclo[7.6.0.02,7.011,15]pentadeca-1(9),7,11(15),12-tetraene-3,5,14-trione |
|---|---|
| PubChem CID | 75609195 |
| Molecular Formula | C12H9N4O3S+ |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 4,6-dimethyl-10-thia-4,6,8-triaza-1-azoniatetracyclo[7.6.0.02,7.011,15]pentadeca-1(9),7,11(15),12-tetraene-3,5,14-trione |
| SMILES | CN1C(=O)C2C(=Nc3sc4c([n+]32)C(=O)C=C4)N(C)C1=O |
| InChI | InChI=1S/C12H9N4O3S/c1-14-9-8(10(18)15(2)12(14)19)16-7-5(17)3-4-6(7)20-11(16)13-9/h3-4,8H,1-2H3/q+1 |
| InChIKey | NNDFCHRJHFFXRK-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 73.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|