C20H34N7O3+ — CID 78171752
N,N-diethyl-4-[3-(1,3,7-trimethyl-2,6-dioxo-5H-purin-7-ium-8-yl)propyl]piperazine-1-carboxamide (PubChem CID 78171752) has the molecular formula C20H34N7O3+ and a molecular weight of 420.54 g/mol. Its IUPAC name is N,N-diethyl-4-[3-(1,3,7-trimethyl-2,6-dioxo-5H-purin-7-ium-8-yl)propyl]piperazine-1-carboxamide.
| Compound Name | N,N-diethyl-4-[3-(1,3,7-trimethyl-2,6-dioxo-5H-purin-7-ium-8-yl)propyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 78171752 |
| Molecular Formula | C20H34N7O3+ |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | N,N-diethyl-4-[3-(1,3,7-trimethyl-2,6-dioxo-5H-purin-7-ium-8-yl)propyl]piperazine-1-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCN(CCCC2=[N+](C)C3C(=O)N(C)C(=O)N(C)C3=N2)CC1 |
| InChI | InChI=1S/C20H34N7O3/c1-6-26(7-2)20(30)27-13-11-25(12-14-27)10-8-9-15-21-17-16(22(15)3)18(28)24(5)19(29)23(17)4/h16H,6-14H2,1-5H3/q+1 |
| InChIKey | INLJQXDIBSWXQG-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 82.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|