C13H18N5O3S+ — CID 78207897
2-[[1,3-dimethyl-7-(2-methylprop-2-enyl)-2,6-dioxo-5H-purin-7-ium-8-yl]sulfanyl]acetamide (PubChem CID 78207897) has the molecular formula C13H18N5O3S+ and a molecular weight of 324.39 g/mol. Its IUPAC name is 2-[[1,3-dimethyl-7-(2-methylprop-2-enyl)-2,6-dioxo-5H-purin-7-ium-8-yl]sulfanyl]acetamide.
| Compound Name | 2-[[1,3-dimethyl-7-(2-methylprop-2-enyl)-2,6-dioxo-5H-purin-7-ium-8-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 78207897 |
| Molecular Formula | C13H18N5O3S+ |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 2-[[1,3-dimethyl-7-(2-methylprop-2-enyl)-2,6-dioxo-5H-purin-7-ium-8-yl]sulfanyl]acetamide |
| SMILES | C=C(C)C[N+]1=C(SCC(N)=O)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C13H17N5O3S/c1-7(2)5-18-9-10(15-12(18)22-6-8(14)19)16(3)13(21)17(4)11(9)20/h9H,1,5-6H2,2-4H3,(H-,14,19)/p+1 |
| InChIKey | NNFPUCIFIRLQQF-UHFFFAOYSA-O |
| XLogP | -0.55 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|