C20H25N6O3+ — CID 78413908
1,3-dimethyl-8-(3-methylanilino)-7-(2-oxo-2-pyrrolidin-1-ylethyl)-5H-purin-7-ium-2,6-dione (PubChem CID 78413908) has the molecular formula C20H25N6O3+ and a molecular weight of 397.46 g/mol. Its IUPAC name is 1,3-dimethyl-8-(3-methylanilino)-7-(2-oxo-2-pyrrolidin-1-ylethyl)-5H-purin-7-ium-2,6-dione.
| Compound Name | 1,3-dimethyl-8-(3-methylanilino)-7-(2-oxo-2-pyrrolidin-1-ylethyl)-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 78413908 |
| Molecular Formula | C20H25N6O3+ |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 1,3-dimethyl-8-(3-methylanilino)-7-(2-oxo-2-pyrrolidin-1-ylethyl)-5H-purin-7-ium-2,6-dione |
| SMILES | Cc1cccc(NC2=[N+](CC(=O)N3CCCC3)C3C(=O)N(C)C(=O)N(C)C3=N2)c1 |
| InChI | InChI=1S/C20H24N6O3/c1-13-7-6-8-14(11-13)21-19-22-17-16(18(28)24(3)20(29)23(17)2)26(19)12-15(27)25-9-4-5-10-25/h6-8,11,16H,4-5,9-10,12H2,1-3H3/p+1 |
| InChIKey | ZUAJVXDXDJKBEP-UHFFFAOYSA-O |
| XLogP | 0.70 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|