C21H30N4O3 — CID 55678721
1-(3-methylphenyl)-3-[2-oxo-2-[4-(piperidine-1-carbonyl)piperidin-1-yl]ethyl]urea (PubChem CID 55678721) has the molecular formula C21H30N4O3 and a molecular weight of 386.50 g/mol. Its IUPAC name is 1-(3-methylphenyl)-3-[2-oxo-2-[4-(piperidine-1-carbonyl)piperidin-1-yl]ethyl]urea.
| Compound Name | 1-(3-methylphenyl)-3-[2-oxo-2-[4-(piperidine-1-carbonyl)piperidin-1-yl]ethyl]urea |
|---|---|
| PubChem CID | 55678721 |
| Molecular Formula | C21H30N4O3 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | 1-(3-methylphenyl)-3-[2-oxo-2-[4-(piperidine-1-carbonyl)piperidin-1-yl]ethyl]urea |
| SMILES | Cc1cccc(NC(=O)NCC(=O)N2CCC(C(=O)N3CCCCC3)CC2)c1 |
| InChI | InChI=1S/C21H30N4O3/c1-16-6-5-7-18(14-16)23-21(28)22-15-19(26)24-12-8-17(9-13-24)20(27)25-10-3-2-4-11-25/h5-7,14,17H,2-4,8-13,15H2,1H3,(H2,22,23,28) |
| InChIKey | XKUAQOVXGDKJNW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |