C18H29ClN4O3 — CID 119664508
1-[2-[4-(3-aminopropoxy)piperidin-1-yl]-2-oxoethyl]-3-(3-methylphenyl)urea;hydrochloride (PubChem CID 119664508) has the molecular formula C18H29ClN4O3 and a molecular weight of 384.91 g/mol. Its IUPAC name is 1-[2-[4-(3-aminopropoxy)piperidin-1-yl]-2-oxoethyl]-3-(3-methylphenyl)urea;hydrochloride.
| Compound Name | 1-[2-[4-(3-aminopropoxy)piperidin-1-yl]-2-oxoethyl]-3-(3-methylphenyl)urea;hydrochloride |
|---|---|
| PubChem CID | 119664508 |
| Molecular Formula | C18H29ClN4O3 |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 1-[2-[4-(3-aminopropoxy)piperidin-1-yl]-2-oxoethyl]-3-(3-methylphenyl)urea;hydrochloride |
| SMILES | Cc1cccc(NC(=O)NCC(=O)N2CCC(OCCCN)CC2)c1.Cl |
| InChI | InChI=1S/C18H28N4O3.ClH/c1-14-4-2-5-15(12-14)21-18(24)20-13-17(23)22-9-6-16(7-10-22)25-11-3-8-19;/h2,4-5,12,16H,3,6-11,13,19H2,1H3,(H2,20,21,24);1H |
| InChIKey | VJONOLLKJLPOMF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|