C21H30N7O3+ — CID 73338290
3-methyl-1-(2-morpholin-4-ylethyl)-7-prop-2-enyl-8-(3,4,5-trimethylpyrazol-1-yl)-5H-purin-7-ium-2,6-dione (PubChem CID 73338290) has the molecular formula C21H30N7O3+ and a molecular weight of 428.52 g/mol. Its IUPAC name is 3-methyl-1-(2-morpholin-4-ylethyl)-7-prop-2-enyl-8-(3,4,5-trimethylpyrazol-1-yl)-5H-purin-7-ium-2,6-dione.
| Compound Name | 3-methyl-1-(2-morpholin-4-ylethyl)-7-prop-2-enyl-8-(3,4,5-trimethylpyrazol-1-yl)-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 73338290 |
| Molecular Formula | C21H30N7O3+ |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | 3-methyl-1-(2-morpholin-4-ylethyl)-7-prop-2-enyl-8-(3,4,5-trimethylpyrazol-1-yl)-5H-purin-7-ium-2,6-dione |
| SMILES | C=CC[N+]1=C(n2nc(C)c(C)c2C)N=C2C1C(=O)N(CCN1CCOCC1)C(=O)N2C |
| InChI | InChI=1S/C21H30N7O3/c1-6-7-26-17-18(22-20(26)28-16(4)14(2)15(3)23-28)24(5)21(30)27(19(17)29)9-8-25-10-12-31-13-11-25/h6,17H,1,7-13H2,2-5H3/q+1 |
| InChIKey | CIXNJRGTPZYPIO-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|