C18H27N6O2+ — CID 73338249
3-methyl-7-propan-2-yl-1-propyl-8-(3,4,5-trimethylpyrazol-1-yl)-5H-purin-7-ium-2,6-dione (PubChem CID 73338249) has the molecular formula C18H27N6O2+ and a molecular weight of 359.45 g/mol. Its IUPAC name is 3-methyl-7-propan-2-yl-1-propyl-8-(3,4,5-trimethylpyrazol-1-yl)-5H-purin-7-ium-2,6-dione.
| Compound Name | 3-methyl-7-propan-2-yl-1-propyl-8-(3,4,5-trimethylpyrazol-1-yl)-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 73338249 |
| Molecular Formula | C18H27N6O2+ |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 3-methyl-7-propan-2-yl-1-propyl-8-(3,4,5-trimethylpyrazol-1-yl)-5H-purin-7-ium-2,6-dione |
| SMILES | CCCN1C(=O)C2C(=NC(n3nc(C)c(C)c3C)=[N+]2C(C)C)N(C)C1=O |
| InChI | InChI=1S/C18H27N6O2/c1-8-9-22-16(25)14-15(21(7)18(22)26)19-17(23(14)10(2)3)24-13(6)11(4)12(5)20-24/h10,14H,8-9H2,1-7H3/q+1 |
| InChIKey | JAWSMKLXKSVWCP-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|