C19H27N6O3+ — CID 73338266
7-butyl-3-methyl-1-(2-oxopropyl)-8-(3,4,5-trimethylpyrazol-1-yl)-5H-purin-7-ium-2,6-dione (PubChem CID 73338266) has the molecular formula C19H27N6O3+ and a molecular weight of 387.46 g/mol. Its IUPAC name is 7-butyl-3-methyl-1-(2-oxopropyl)-8-(3,4,5-trimethylpyrazol-1-yl)-5H-purin-7-ium-2,6-dione.
| Compound Name | 7-butyl-3-methyl-1-(2-oxopropyl)-8-(3,4,5-trimethylpyrazol-1-yl)-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 73338266 |
| Molecular Formula | C19H27N6O3+ |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | 7-butyl-3-methyl-1-(2-oxopropyl)-8-(3,4,5-trimethylpyrazol-1-yl)-5H-purin-7-ium-2,6-dione |
| SMILES | CCCC[N+]1=C(n2nc(C)c(C)c2C)N=C2C1C(=O)N(CC(C)=O)C(=O)N2C |
| InChI | InChI=1S/C19H27N6O3/c1-7-8-9-23-15-16(20-18(23)25-14(5)12(3)13(4)21-25)22(6)19(28)24(17(15)27)10-11(2)26/h15H,7-10H2,1-6H3/q+1 |
| InChIKey | IJXUZFZGLJPJKL-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 90.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|