C19H30N7O2+ — CID 167999422
3,9-dimethyl-1-(2-piperidin-1-ylethyl)-7-propyl-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione (PubChem CID 167999422) has the molecular formula C19H30N7O2+ and a molecular weight of 388.50 g/mol. Its IUPAC name is 3,9-dimethyl-1-(2-piperidin-1-ylethyl)-7-propyl-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione.
| Compound Name | 3,9-dimethyl-1-(2-piperidin-1-ylethyl)-7-propyl-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione |
|---|---|
| PubChem CID | 167999422 |
| Molecular Formula | C19H30N7O2+ |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | 3,9-dimethyl-1-(2-piperidin-1-ylethyl)-7-propyl-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione |
| SMILES | CCCN1C(=O)C2C(=NC3=[N+]2CC(C)=NN3CCN2CCCCC2)N(C)C1=O |
| InChI | InChI=1S/C19H30N7O2/c1-4-8-24-17(27)15-16(22(3)19(24)28)20-18-25(15)13-14(2)21-26(18)12-11-23-9-6-5-7-10-23/h15H,4-13H2,1-3H3/q+1 |
| InChIKey | LLISUHQQVREZAK-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|