C17H27N6O3+ — CID 73393970
1-(3-hydroxypropyl)-3,9-dimethyl-7-pentyl-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione (PubChem CID 73393970) has the molecular formula C17H27N6O3+ and a molecular weight of 363.44 g/mol. Its IUPAC name is 1-(3-hydroxypropyl)-3,9-dimethyl-7-pentyl-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione.
| Compound Name | 1-(3-hydroxypropyl)-3,9-dimethyl-7-pentyl-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione |
|---|---|
| PubChem CID | 73393970 |
| Molecular Formula | C17H27N6O3+ |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 1-(3-hydroxypropyl)-3,9-dimethyl-7-pentyl-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione |
| SMILES | CCCCCN1C(=O)C2C(=NC3=[N+]2CC(C)=NN3CCCO)N(C)C1=O |
| InChI | InChI=1S/C17H27N6O3/c1-4-5-6-8-21-15(25)13-14(20(3)17(21)26)18-16-22(13)11-12(2)19-23(16)9-7-10-24/h13,24H,4-11H2,1-3H3/q+1 |
| InChIKey | WNITUGGXNKBNOF-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|