C12H15N6O4+ — CID 167999361
2-(3,7,9-trimethyl-6,8-dioxo-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-1-yl)acetic acid (PubChem CID 167999361) has the molecular formula C12H15N6O4+ and a molecular weight of 307.29 g/mol. Its IUPAC name is 2-(3,7,9-trimethyl-6,8-dioxo-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-1-yl)acetic acid.
| Compound Name | 2-(3,7,9-trimethyl-6,8-dioxo-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-1-yl)acetic acid |
|---|---|
| PubChem CID | 167999361 |
| Molecular Formula | C12H15N6O4+ |
| Molecular Weight | 307.29 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 2-(3,7,9-trimethyl-6,8-dioxo-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-1-yl)acetic acid |
| SMILES | CC1=NN(CC(=O)O)C2=[N+](C1)C1C(=O)N(C)C(=O)N(C)C1=N2 |
| InChI | InChI=1S/C12H14N6O4/c1-6-4-17-8-9(15(2)12(22)16(3)10(8)21)13-11(17)18(14-6)5-7(19)20/h8H,4-5H2,1-3H3/p+1 |
| InChIKey | VOKLVCRJDDUQMP-UHFFFAOYSA-O |
| XLogP | -1.56 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.29 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|