C22H28ClN8O2+ — CID 167999555
1-[2-[4-(3-chlorophenyl)piperazin-1-yl]ethyl]-3,7,9-trimethyl-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione (PubChem CID 167999555) has the molecular formula C22H28ClN8O2+ and a molecular weight of 471.97 g/mol. Its IUPAC name is 1-[2-[4-(3-chlorophenyl)piperazin-1-yl]ethyl]-3,7,9-trimethyl-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione.
| Compound Name | 1-[2-[4-(3-chlorophenyl)piperazin-1-yl]ethyl]-3,7,9-trimethyl-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione |
|---|---|
| PubChem CID | 167999555 |
| Molecular Formula | C22H28ClN8O2+ |
| Molecular Weight | 471.97 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | 1-[2-[4-(3-chlorophenyl)piperazin-1-yl]ethyl]-3,7,9-trimethyl-4,5a-dihydropurino[8,7-c][1,2,4]triazin-5-ium-6,8-dione |
| SMILES | CC1=NN(CCN2CCN(c3cccc(Cl)c3)CC2)C2=[N+](C1)C1C(=O)N(C)C(=O)N(C)C1=N2 |
| InChI | InChI=1S/C22H28ClN8O2/c1-15-14-30-18-19(26(2)22(33)27(3)20(18)32)24-21(30)31(25-15)12-9-28-7-10-29(11-8-28)17-6-4-5-16(23)13-17/h4-6,13,18H,7-12,14H2,1-3H3/q+1 |
| InChIKey | XRJZFGUXBJQDIS-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 78.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.97 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|