C18H29N4O2S+ — CID 78302962
2-decyl-4-methyl-8,9a-dihydro-7H-purino[8,7-b][1,3]thiazol-9-ium-1,3-dione (PubChem CID 78302962) has the molecular formula C18H29N4O2S+ and a molecular weight of 365.52 g/mol. Its IUPAC name is 2-decyl-4-methyl-8,9a-dihydro-7H-purino[8,7-b][1,3]thiazol-9-ium-1,3-dione.
| Compound Name | 2-decyl-4-methyl-8,9a-dihydro-7H-purino[8,7-b][1,3]thiazol-9-ium-1,3-dione |
|---|---|
| PubChem CID | 78302962 |
| Molecular Formula | C18H29N4O2S+ |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 2-decyl-4-methyl-8,9a-dihydro-7H-purino[8,7-b][1,3]thiazol-9-ium-1,3-dione |
| SMILES | CCCCCCCCCCN1C(=O)C2C(=NC3=[N+]2CCS3)N(C)C1=O |
| InChI | InChI=1S/C18H29N4O2S/c1-3-4-5-6-7-8-9-10-11-22-16(23)14-15(20(2)18(22)24)19-17-21(14)12-13-25-17/h14H,3-13H2,1-2H3/q+1 |
| InChIKey | HYGQCUSUIRHVJJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|