C15H21N6O2+ — CID 73337949
8-(3,5-dimethylpyrazol-1-yl)-3,7-dimethyl-1-propyl-5H-purin-7-ium-2,6-dione (PubChem CID 73337949) has the molecular formula C15H21N6O2+ and a molecular weight of 317.37 g/mol. Its IUPAC name is 8-(3,5-dimethylpyrazol-1-yl)-3,7-dimethyl-1-propyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 8-(3,5-dimethylpyrazol-1-yl)-3,7-dimethyl-1-propyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 73337949 |
| Molecular Formula | C15H21N6O2+ |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 8-(3,5-dimethylpyrazol-1-yl)-3,7-dimethyl-1-propyl-5H-purin-7-ium-2,6-dione |
| SMILES | CCCN1C(=O)C2C(=NC(n3nc(C)cc3C)=[N+]2C)N(C)C1=O |
| InChI | InChI=1S/C15H21N6O2/c1-6-7-20-13(22)11-12(19(5)15(20)23)16-14(18(11)4)21-10(3)8-9(2)17-21/h8,11H,6-7H2,1-5H3/q+1 |
| InChIKey | LPVXBWUERNPZIQ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|