C16H21N6O2+ — CID 167999567
1-[(E)-but-2-enyl]-8-(3,5-dimethylpyrazol-1-yl)-3,7-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 167999567) has the molecular formula C16H21N6O2+ and a molecular weight of 329.38 g/mol. Its IUPAC name is 1-[(E)-but-2-enyl]-8-(3,5-dimethylpyrazol-1-yl)-3,7-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 1-[(E)-but-2-enyl]-8-(3,5-dimethylpyrazol-1-yl)-3,7-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 167999567 |
| Molecular Formula | C16H21N6O2+ |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 1-[(E)-but-2-enyl]-8-(3,5-dimethylpyrazol-1-yl)-3,7-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | C/C=C/CN1C(=O)C2C(=NC(n3nc(C)cc3C)=[N+]2C)N(C)C1=O |
| InChI | InChI=1S/C16H21N6O2/c1-6-7-8-21-14(23)12-13(20(5)16(21)24)17-15(19(12)4)22-11(3)9-10(2)18-22/h6-7,9,12H,8H2,1-5H3/q+1/b7-6+ |
| InChIKey | PZPWSQNRQNNFQW-VOTSOKGWSA-N |
| XLogP | 0.60 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|