C21H25N6O3+ — CID 74773854
8-(3,5-dimethylpyrazol-1-yl)-1-ethyl-7-[(4-methoxyphenyl)methyl]-3-methyl-5H-purin-7-ium-2,6-dione (PubChem CID 74773854) has the molecular formula C21H25N6O3+ and a molecular weight of 409.47 g/mol. Its IUPAC name is 8-(3,5-dimethylpyrazol-1-yl)-1-ethyl-7-[(4-methoxyphenyl)methyl]-3-methyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 8-(3,5-dimethylpyrazol-1-yl)-1-ethyl-7-[(4-methoxyphenyl)methyl]-3-methyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 74773854 |
| Molecular Formula | C21H25N6O3+ |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 8-(3,5-dimethylpyrazol-1-yl)-1-ethyl-7-[(4-methoxyphenyl)methyl]-3-methyl-5H-purin-7-ium-2,6-dione |
| SMILES | CCN1C(=O)C2C(=NC(n3nc(C)cc3C)=[N+]2Cc2ccc(OC)cc2)N(C)C1=O |
| InChI | InChI=1S/C21H25N6O3/c1-6-25-19(28)17-18(24(4)21(25)29)22-20(27-14(3)11-13(2)23-27)26(17)12-15-7-9-16(30-5)10-8-15/h7-11,17H,6,12H2,1-5H3/q+1 |
| InChIKey | XTWLUZLRVQRKTD-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 83.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|