C21H24ClN6O3+ — CID 73338141
1-[(4-chlorophenyl)methyl]-8-(3,5-dimethylpyrazol-1-yl)-7-(2-methoxyethyl)-3-methyl-5H-purin-7-ium-2,6-dione (PubChem CID 73338141) has the molecular formula C21H24ClN6O3+ and a molecular weight of 443.92 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-8-(3,5-dimethylpyrazol-1-yl)-7-(2-methoxyethyl)-3-methyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 1-[(4-chlorophenyl)methyl]-8-(3,5-dimethylpyrazol-1-yl)-7-(2-methoxyethyl)-3-methyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 73338141 |
| Molecular Formula | C21H24ClN6O3+ |
| Molecular Weight | 443.92 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-8-(3,5-dimethylpyrazol-1-yl)-7-(2-methoxyethyl)-3-methyl-5H-purin-7-ium-2,6-dione |
| SMILES | COCC[N+]1=C(n2nc(C)cc2C)N=C2C1C(=O)N(Cc1ccc(Cl)cc1)C(=O)N2C |
| InChI | InChI=1S/C21H24ClN6O3/c1-13-11-14(2)28(24-13)20-23-18-17(26(20)9-10-31-4)19(29)27(21(30)25(18)3)12-15-5-7-16(22)8-6-15/h5-8,11,17H,9-10,12H2,1-4H3/q+1 |
| InChIKey | QLOAWOYDXJOWNK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 83.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.92 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|