C19H19Cl2N6O2+ — CID 73337963
1-[(2,4-dichlorophenyl)methyl]-8-(3,5-dimethylpyrazol-1-yl)-3,7-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 73337963) has the molecular formula C19H19Cl2N6O2+ and a molecular weight of 434.31 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-8-(3,5-dimethylpyrazol-1-yl)-3,7-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-8-(3,5-dimethylpyrazol-1-yl)-3,7-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 73337963 |
| Molecular Formula | C19H19Cl2N6O2+ |
| Molecular Weight | 434.31 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-8-(3,5-dimethylpyrazol-1-yl)-3,7-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | Cc1cc(C)n(C2=[N+](C)C3C(=O)N(Cc4ccc(Cl)cc4Cl)C(=O)N(C)C3=N2)n1 |
| InChI | InChI=1S/C19H19Cl2N6O2/c1-10-7-11(2)27(23-10)18-22-16-15(24(18)3)17(28)26(19(29)25(16)4)9-12-5-6-13(20)8-14(12)21/h5-8,15H,9H2,1-4H3/q+1 |
| InChIKey | LUSXIZMERQBYPP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.31 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|