C22H26FN6O2+ — CID 73338061
8-(3,5-dimethylpyrazol-1-yl)-1-[(4-fluorophenyl)methyl]-3-methyl-7-(2-methylpropyl)-5H-purin-7-ium-2,6-dione (PubChem CID 73338061) has the molecular formula C22H26FN6O2+ and a molecular weight of 425.49 g/mol. Its IUPAC name is 8-(3,5-dimethylpyrazol-1-yl)-1-[(4-fluorophenyl)methyl]-3-methyl-7-(2-methylpropyl)-5H-purin-7-ium-2,6-dione.
| Compound Name | 8-(3,5-dimethylpyrazol-1-yl)-1-[(4-fluorophenyl)methyl]-3-methyl-7-(2-methylpropyl)-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 73338061 |
| Molecular Formula | C22H26FN6O2+ |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 8-(3,5-dimethylpyrazol-1-yl)-1-[(4-fluorophenyl)methyl]-3-methyl-7-(2-methylpropyl)-5H-purin-7-ium-2,6-dione |
| SMILES | Cc1cc(C)n(C2=[N+](CC(C)C)C3C(=O)N(Cc4ccc(F)cc4)C(=O)N(C)C3=N2)n1 |
| InChI | InChI=1S/C22H26FN6O2/c1-13(2)11-27-18-19(24-21(27)29-15(4)10-14(3)25-29)26(5)22(31)28(20(18)30)12-16-6-8-17(23)9-7-16/h6-10,13,18H,11-12H2,1-5H3/q+1 |
| InChIKey | GYCZCVWETMGMHS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|