C14H14ClN4O2+ — CID 78206693
1-[(2-chlorophenyl)methyl]-3,7-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 78206693) has the molecular formula C14H14ClN4O2+ and a molecular weight of 305.75 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-3,7-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 1-[(2-chlorophenyl)methyl]-3,7-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 78206693 |
| Molecular Formula | C14H14ClN4O2+ |
| Molecular Weight | 305.75 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-3,7-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | CN1C(=O)N(Cc2ccccc2Cl)C(=O)C2C1=NC=[N+]2C |
| InChI | InChI=1S/C14H14ClN4O2/c1-17-8-16-12-11(17)13(20)19(14(21)18(12)2)7-9-5-3-4-6-10(9)15/h3-6,8,11H,7H2,1-2H3/q+1 |
| InChIKey | CEKORKZWRBTHRT-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.75 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|