C10H11N4O2+ — CID 76845260
3,7-dimethyl-1-prop-2-ynyl-5H-purin-7-ium-2,6-dione (PubChem CID 76845260) has the molecular formula C10H11N4O2+ and a molecular weight of 219.22 g/mol. Its IUPAC name is 3,7-dimethyl-1-prop-2-ynyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 3,7-dimethyl-1-prop-2-ynyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 76845260 |
| Molecular Formula | C10H11N4O2+ |
| Molecular Weight | 219.22 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 3,7-dimethyl-1-prop-2-ynyl-5H-purin-7-ium-2,6-dione |
| SMILES | C#CCN1C(=O)C2C(=NC=[N+]2C)N(C)C1=O |
| InChI | InChI=1S/C10H11N4O2/c1-4-5-14-9(15)7-8(11-6-12(7)2)13(3)10(14)16/h1,6-7H,5H2,2-3H3/q+1 |
| InChIKey | WDFINLIVVQVOHD-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.22 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|