C13H19N4O3+ — CID 71627811
3,7-dimethyl-1-(5-oxohexyl)-5H-purin-7-ium-2,6-dione (PubChem CID 71627811) has the molecular formula C13H19N4O3+ and a molecular weight of 279.32 g/mol. Its IUPAC name is 3,7-dimethyl-1-(5-oxohexyl)-5H-purin-7-ium-2,6-dione.
| Compound Name | 3,7-dimethyl-1-(5-oxohexyl)-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 71627811 |
| Molecular Formula | C13H19N4O3+ |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 3,7-dimethyl-1-(5-oxohexyl)-5H-purin-7-ium-2,6-dione |
| SMILES | CC(=O)CCCCN1C(=O)C2C(=NC=[N+]2C)N(C)C1=O |
| InChI | InChI=1S/C13H19N4O3/c1-9(18)6-4-5-7-17-12(19)10-11(14-8-15(10)2)16(3)13(17)20/h8,10H,4-7H2,1-3H3/q+1 |
| InChIKey | XAZHJDUQMYELJQ-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 73.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|