C15H22N5O3+ — CID 85456734
1-[2-(azepan-1-yl)-2-oxoethyl]-3,7-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 85456734) has the molecular formula C15H22N5O3+ and a molecular weight of 320.37 g/mol. Its IUPAC name is 1-[2-(azepan-1-yl)-2-oxoethyl]-3,7-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 1-[2-(azepan-1-yl)-2-oxoethyl]-3,7-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 85456734 |
| Molecular Formula | C15H22N5O3+ |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 1-[2-(azepan-1-yl)-2-oxoethyl]-3,7-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | CN1C(=O)N(CC(=O)N2CCCCCC2)C(=O)C2C1=NC=[N+]2C |
| InChI | InChI=1S/C15H22N5O3/c1-17-10-16-13-12(17)14(22)20(15(23)18(13)2)9-11(21)19-7-5-3-4-6-8-19/h10,12H,3-9H2,1-2H3/q+1 |
| InChIKey | KQJQVWJGXRWBBQ-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|